C23H25N3O4S2 — CID 4243539
ethyl 2-[[11-methyl-4-(3-methylphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]-3-oxobutanoate (PubChem CID 4243539) has the molecular formula C23H25N3O4S2 and a molecular weight of 471.60 g/mol. Its IUPAC name is ethyl 2-[[11-methyl-4-(3-methylphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]-3-oxobutanoate.
| Compound Name | ethyl 2-[[11-methyl-4-(3-methylphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 4243539 |
| Molecular Formula | C23H25N3O4S2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | ethyl 2-[[11-methyl-4-(3-methylphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]-3-oxobutanoate |
| SMILES | CCOC(=O)C(Sc1nc2sc3c(c2c(=O)n1-c1cccc(C)c1)CCN(C)C3)C(C)=O |
| InChI | InChI=1S/C23H25N3O4S2/c1-5-30-22(29)19(14(3)27)32-23-24-20-18(16-9-10-25(4)12-17(16)31-20)21(28)26(23)15-8-6-7-13(2)11-15/h6-8,11,19H,5,9-10,12H2,1-4H3 |
| InChIKey | POPHYSRKXQYNAL-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|