C20H20ClN3O3S2 — CID 3875737
4-(3-chlorophenyl)-5-(1,3-dioxolan-2-ylmethylsulfanyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 3875737) has the molecular formula C20H20ClN3O3S2 and a molecular weight of 449.99 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-5-(1,3-dioxolan-2-ylmethylsulfanyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 4-(3-chlorophenyl)-5-(1,3-dioxolan-2-ylmethylsulfanyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 3875737 |
| Molecular Formula | C20H20ClN3O3S2 |
| Molecular Weight | 449.99 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | 4-(3-chlorophenyl)-5-(1,3-dioxolan-2-ylmethylsulfanyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | CN1CCc2c(sc3nc(SCC4OCCO4)n(-c4cccc(Cl)c4)c(=O)c23)C1 |
| InChI | InChI=1S/C20H20ClN3O3S2/c1-23-6-5-14-15(10-23)29-18-17(14)19(25)24(13-4-2-3-12(21)9-13)20(22-18)28-11-16-26-7-8-27-16/h2-4,9,16H,5-8,10-11H2,1H3 |
| InChIKey | VIEARKDOZUPFDZ-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.99 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |