C22H27ClN4O3S — CID 28913495
5-[bis[(2S)-2-hydroxypropyl]amino]-4-(3-chlorophenyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 28913495) has the molecular formula C22H27ClN4O3S and a molecular weight of 463.00 g/mol. Its IUPAC name is 5-[bis[(2S)-2-hydroxypropyl]amino]-4-(3-chlorophenyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 5-[bis[(2S)-2-hydroxypropyl]amino]-4-(3-chlorophenyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 28913495 |
| Molecular Formula | C22H27ClN4O3S |
| Molecular Weight | 463.00 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 5-[bis[(2S)-2-hydroxypropyl]amino]-4-(3-chlorophenyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | C[C@H](O)CN(C[C@H](C)O)c1nc2sc3c(c2c(=O)n1-c1cccc(Cl)c1)CCN(C)C3 |
| InChI | InChI=1S/C22H27ClN4O3S/c1-13(28)10-26(11-14(2)29)22-24-20-19(17-7-8-25(3)12-18(17)31-20)21(30)27(22)16-6-4-5-15(23)9-16/h4-6,9,13-14,28-29H,7-8,10-12H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | ZBPCTNGCKPUVSG-KBPBESRZSA-N |
| XLogP | 2.66 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.00 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |