C25H23ClN4O2S2 — CID 18849341
N-(3-chlorophenyl)-2-[[11-methyl-4-(4-methylphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]acetamide (PubChem CID 18849341) has the molecular formula C25H23ClN4O2S2 and a molecular weight of 511.07 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[[11-methyl-4-(4-methylphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[[11-methyl-4-(4-methylphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 18849341 |
| Molecular Formula | C25H23ClN4O2S2 |
| Molecular Weight | 511.07 g/mol |
| Exact Mass | 510.10 |
| IUPAC Name | N-(3-chlorophenyl)-2-[[11-methyl-4-(4-methylphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(-n2c(SCC(=O)Nc3cccc(Cl)c3)nc3sc4c(c3c2=O)CCN(C)C4)cc1 |
| InChI | InChI=1S/C25H23ClN4O2S2/c1-15-6-8-18(9-7-15)30-24(32)22-19-10-11-29(2)13-20(19)34-23(22)28-25(30)33-14-21(31)27-17-5-3-4-16(26)12-17/h3-9,12H,10-11,13-14H2,1-2H3,(H,27,31) |
| InChIKey | NPYUEKRBIKHGSI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.07 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |