C26H25ClN4O2S2 — CID 18849573
N-(3-chlorophenyl)-2-[[11-ethyl-4-(4-methylphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]acetamide (PubChem CID 18849573) has the molecular formula C26H25ClN4O2S2 and a molecular weight of 525.10 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[[11-ethyl-4-(4-methylphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]acetamide.
| Compound Name | N-(3-chlorophenyl)-2-[[11-ethyl-4-(4-methylphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 18849573 |
| Molecular Formula | C26H25ClN4O2S2 |
| Molecular Weight | 525.10 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | N-(3-chlorophenyl)-2-[[11-ethyl-4-(4-methylphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]acetamide |
| SMILES | CCN1CCc2c(sc3nc(SCC(=O)Nc4cccc(Cl)c4)n(-c4ccc(C)cc4)c(=O)c23)C1 |
| InChI | InChI=1S/C26H25ClN4O2S2/c1-3-30-12-11-20-21(14-30)35-24-23(20)25(33)31(19-9-7-16(2)8-10-19)26(29-24)34-15-22(32)28-18-6-4-5-17(27)13-18/h4-10,13H,3,11-12,14-15H2,1-2H3,(H,28,32) |
| InChIKey | VHBWIIGOWMQPAY-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.10 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |