C32H29ClN4O3S2 — CID 18849495
2-[[11-benzyl-4-(4-ethoxyphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]-N-(4-chlorophenyl)acetamide (PubChem CID 18849495) has the molecular formula C32H29ClN4O3S2 and a molecular weight of 617.20 g/mol. Its IUPAC name is 2-[[11-benzyl-4-(4-ethoxyphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[[11-benzyl-4-(4-ethoxyphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 18849495 |
| Molecular Formula | C32H29ClN4O3S2 |
| Molecular Weight | 617.20 g/mol |
| Exact Mass | 616.14 |
| IUPAC Name | 2-[[11-benzyl-4-(4-ethoxyphenyl)-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]-N-(4-chlorophenyl)acetamide |
| SMILES | CCOc1ccc(-n2c(SCC(=O)Nc3ccc(Cl)cc3)nc3sc4c(c3c2=O)CCN(Cc2ccccc2)C4)cc1 |
| InChI | InChI=1S/C32H29ClN4O3S2/c1-2-40-25-14-12-24(13-15-25)37-31(39)29-26-16-17-36(18-21-6-4-3-5-7-21)19-27(26)42-30(29)35-32(37)41-20-28(38)34-23-10-8-22(33)9-11-23/h3-15H,2,16-20H2,1H3,(H,34,38) |
| InChIKey | QSPRNMJFFYCEKQ-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.20 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |