C33H30FN3O4S2 — CID 18849511
11-benzyl-4-(4-ethoxyphenyl)-5-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]sulfanyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 18849511) has the molecular formula C33H30FN3O4S2 and a molecular weight of 615.75 g/mol. Its IUPAC name is 11-benzyl-4-(4-ethoxyphenyl)-5-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]sulfanyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 11-benzyl-4-(4-ethoxyphenyl)-5-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]sulfanyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 18849511 |
| Molecular Formula | C33H30FN3O4S2 |
| Molecular Weight | 615.75 g/mol |
| Exact Mass | 615.17 |
| IUPAC Name | 11-benzyl-4-(4-ethoxyphenyl)-5-[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl]sulfanyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | CCOc1ccc(-n2c(SCC(=O)c3ccc(OC)c(F)c3)nc3sc4c(c3c2=O)CCN(Cc2ccccc2)C4)cc1 |
| InChI | InChI=1S/C33H30FN3O4S2/c1-3-41-24-12-10-23(11-13-24)37-32(39)30-25-15-16-36(18-21-7-5-4-6-8-21)19-29(25)43-31(30)35-33(37)42-20-27(38)22-9-14-28(40-2)26(34)17-22/h4-14,17H,3,15-16,18-20H2,1-2H3 |
| InChIKey | HOHRARDCQHAUQM-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.75 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |