C29H32N4O4S2 — CID 18849645
N-(4-ethoxyphenyl)-2-[[4-(4-ethoxyphenyl)-11-ethyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]acetamide (PubChem CID 18849645) has the molecular formula C29H32N4O4S2 and a molecular weight of 564.73 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-2-[[4-(4-ethoxyphenyl)-11-ethyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]acetamide.
| Compound Name | N-(4-ethoxyphenyl)-2-[[4-(4-ethoxyphenyl)-11-ethyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 18849645 |
| Molecular Formula | C29H32N4O4S2 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | N-(4-ethoxyphenyl)-2-[[4-(4-ethoxyphenyl)-11-ethyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl]sulfanyl]acetamide |
| SMILES | CCOc1ccc(NC(=O)CSc2nc3sc4c(c3c(=O)n2-c2ccc(OCC)cc2)CCN(CC)C4)cc1 |
| InChI | InChI=1S/C29H32N4O4S2/c1-4-32-16-15-23-24(17-32)39-27-26(23)28(35)33(20-9-13-22(14-10-20)37-6-3)29(31-27)38-18-25(34)30-19-7-11-21(12-8-19)36-5-2/h7-14H,4-6,15-18H2,1-3H3,(H,30,34) |
| InChIKey | IWOQUNDSVOGDMK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |