C35H34N4O4S2 — CID 23885396
4-[[2-[[3-(3,5-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetyl]amino]-N-(4-ethoxyphenyl)benzamide (PubChem CID 23885396) has the molecular formula C35H34N4O4S2 and a molecular weight of 638.82 g/mol. Its IUPAC name is 4-[[2-[[3-(3,5-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetyl]amino]-N-(4-ethoxyphenyl)benzamide.
| Compound Name | 4-[[2-[[3-(3,5-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetyl]amino]-N-(4-ethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 23885396 |
| Molecular Formula | C35H34N4O4S2 |
| Molecular Weight | 638.82 g/mol |
| Exact Mass | 638.20 |
| IUPAC Name | 4-[[2-[[3-(3,5-dimethylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetyl]amino]-N-(4-ethoxyphenyl)benzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccc(NC(=O)CSc3nc4sc5c(c4c(=O)n3-c3cc(C)cc(C)c3)CCCC5)cc2)cc1 |
| InChI | InChI=1S/C35H34N4O4S2/c1-4-43-27-15-13-25(14-16-27)37-32(41)23-9-11-24(12-10-23)36-30(40)20-44-35-38-33-31(28-7-5-6-8-29(28)45-33)34(42)39(35)26-18-21(2)17-22(3)19-26/h9-19H,4-8,20H2,1-3H3,(H,36,40)(H,37,41) |
| InChIKey | FXONXHCRUXJOSP-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.82 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |