C28H28N4O4S2 — CID 50799609
2-[(11-acetyl-4-benzyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl)sulfanyl]-N-(4-ethoxyphenyl)acetamide (PubChem CID 50799609) has the molecular formula C28H28N4O4S2 and a molecular weight of 548.69 g/mol. Its IUPAC name is 2-[(11-acetyl-4-benzyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl)sulfanyl]-N-(4-ethoxyphenyl)acetamide.
| Compound Name | 2-[(11-acetyl-4-benzyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl)sulfanyl]-N-(4-ethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 50799609 |
| Molecular Formula | C28H28N4O4S2 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | 2-[(11-acetyl-4-benzyl-3-oxo-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl)sulfanyl]-N-(4-ethoxyphenyl)acetamide |
| SMILES | CCOc1ccc(NC(=O)CSc2nc3sc4c(c3c(=O)n2Cc2ccccc2)CCN(C(C)=O)C4)cc1 |
| InChI | InChI=1S/C28H28N4O4S2/c1-3-36-21-11-9-20(10-12-21)29-24(34)17-37-28-30-26-25(22-13-14-31(18(2)33)16-23(22)38-26)27(35)32(28)15-19-7-5-4-6-8-19/h4-12H,3,13-17H2,1-2H3,(H,29,34) |
| InChIKey | KDWISYIYWQPIJL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |