C31H25F3N4O2S2 — CID 18849417
2-[(11-benzyl-3-oxo-4-phenyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl)sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 18849417) has the molecular formula C31H25F3N4O2S2 and a molecular weight of 606.70 g/mol. Its IUPAC name is 2-[(11-benzyl-3-oxo-4-phenyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl)sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(11-benzyl-3-oxo-4-phenyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl)sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 18849417 |
| Molecular Formula | C31H25F3N4O2S2 |
| Molecular Weight | 606.70 g/mol |
| Exact Mass | 606.14 |
| IUPAC Name | 2-[(11-benzyl-3-oxo-4-phenyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl)sulfanyl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CSc1nc2sc3c(c2c(=O)n1-c1ccccc1)CCN(Cc1ccccc1)C3)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H25F3N4O2S2/c32-31(33,34)21-10-7-11-22(16-21)35-26(39)19-41-30-36-28-27(29(40)38(30)23-12-5-2-6-13-23)24-14-15-37(18-25(24)42-28)17-20-8-3-1-4-9-20/h1-13,16H,14-15,17-19H2,(H,35,39) |
| InChIKey | MNPFHEXDUHWBEC-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.70 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |