C32H30N4O2S2 — CID 4918158
2-[(11-benzyl-3-oxo-4-phenyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl)sulfanyl]-N-(2,4-dimethylphenyl)acetamide (PubChem CID 4918158) has the molecular formula C32H30N4O2S2 and a molecular weight of 566.75 g/mol. Its IUPAC name is 2-[(11-benzyl-3-oxo-4-phenyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl)sulfanyl]-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | 2-[(11-benzyl-3-oxo-4-phenyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl)sulfanyl]-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 4918158 |
| Molecular Formula | C32H30N4O2S2 |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | 2-[(11-benzyl-3-oxo-4-phenyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-5-yl)sulfanyl]-N-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CSc2nc3sc4c(c3c(=O)n2-c2ccccc2)CCN(Cc2ccccc2)C4)c(C)c1 |
| InChI | InChI=1S/C32H30N4O2S2/c1-21-13-14-26(22(2)17-21)33-28(37)20-39-32-34-30-29(31(38)36(32)24-11-7-4-8-12-24)25-15-16-35(19-27(25)40-30)18-23-9-5-3-6-10-23/h3-14,17H,15-16,18-20H2,1-2H3,(H,33,37) |
| InChIKey | GQNMKFYYWRUYSD-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |