C24H21Cl2N3O2S2 — CID 18849377
5-[(2,4-dichlorophenyl)methylsulfanyl]-4-(4-methoxyphenyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 18849377) has the molecular formula C24H21Cl2N3O2S2 and a molecular weight of 518.49 g/mol. Its IUPAC name is 5-[(2,4-dichlorophenyl)methylsulfanyl]-4-(4-methoxyphenyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 5-[(2,4-dichlorophenyl)methylsulfanyl]-4-(4-methoxyphenyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 18849377 |
| Molecular Formula | C24H21Cl2N3O2S2 |
| Molecular Weight | 518.49 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | 5-[(2,4-dichlorophenyl)methylsulfanyl]-4-(4-methoxyphenyl)-11-methyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | COc1ccc(-n2c(SCc3ccc(Cl)cc3Cl)nc3sc4c(c3c2=O)CCN(C)C4)cc1 |
| InChI | InChI=1S/C24H21Cl2N3O2S2/c1-28-10-9-18-20(12-28)33-22-21(18)23(30)29(16-5-7-17(31-2)8-6-16)24(27-22)32-13-14-3-4-15(25)11-19(14)26/h3-8,11H,9-10,12-13H2,1-2H3 |
| InChIKey | QXSPHYOLGDABTF-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.49 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |