C23H20N5OS+ — CID 7644429
3-(13-benzyl-10-thia-3,5,6,8-tetraza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)phenol (PubChem CID 7644429) has the molecular formula C23H20N5OS+ and a molecular weight of 414.51 g/mol. Its IUPAC name is 3-(13-benzyl-10-thia-3,5,6,8-tetraza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)phenol.
| Compound Name | 3-(13-benzyl-10-thia-3,5,6,8-tetraza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)phenol |
|---|---|
| PubChem CID | 7644429 |
| Molecular Formula | C23H20N5OS+ |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 3-(13-benzyl-10-thia-3,5,6,8-tetraza-13-azoniatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-4-yl)phenol |
| SMILES | Oc1cccc(-c2nc3c4c5c(sc4ncn3n2)C[NH+](Cc2ccccc2)CC5)c1 |
| InChI | InChI=1S/C23H19N5OS/c29-17-8-4-7-16(11-17)21-25-22-20-18-9-10-27(12-15-5-2-1-3-6-15)13-19(18)30-23(20)24-14-28(22)26-21/h1-8,11,14,29H,9-10,12-13H2/p+1 |
| InChIKey | CRCNRJFPVYVAFW-UHFFFAOYSA-O |
| XLogP | 2.85 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |