About 3-(furan-2-yl)-1,5-bis(methylsulfanyl)-1,2,4-triazole
3-(furan-2-yl)-1,5-bis(methylsulfanyl)-1,2,4-triazole (PubChem CID 175630714) has the molecular formula C8H9N3OS2
and a molecular weight of 227.31 g/mol. Its IUPAC name is 3-(furan-2-yl)-1,5-bis(methylsulfanyl)-1,2,4-triazole.
Analyze 3-(furan-2-yl)-1,5-bis(methylsulfanyl)-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(furan-2-yl)-1,5-bis(methylsulfanyl)-1,2,4-triazole?
The IUPAC name of 3-(furan-2-yl)-1,5-bis(methylsulfanyl)-1,2,4-triazole (CID 175630714) is 3-(furan-2-yl)-1,5-bis(methylsulfanyl)-1,2,4-triazole.
What is the SMILES notation for 3-(furan-2-yl)-1,5-bis(methylsulfanyl)-1,2,4-triazole?
The canonical SMILES for 3-(furan-2-yl)-1,5-bis(methylsulfanyl)-1,2,4-triazole is CSc1nc(-c2ccco2)nn1SC.
What is the InChIKey of 3-(furan-2-yl)-1,5-bis(methylsulfanyl)-1,2,4-triazole?
The InChIKey is DXCBEHIZWADVRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3OS2/c1-13-8-9-7(10-11(8)14-2)6-4-3-5-12-6/h3-5H,1-2H3.
What are the key properties of 3-(furan-2-yl)-1,5-bis(methylsulfanyl)-1,2,4-triazole?
3-(furan-2-yl)-1,5-bis(methylsulfanyl)-1,2,4-triazole has a molecular weight of 227.31 g/mol, XLogP of 2.39, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-2-yl)-1,5-bis(methylsulfanyl)-1,2,4-triazole is sourced from PubChem (CID 175630714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).