C8H6ClN3OS — CID 12870888
2-chloro-4-(furan-2-yl)-6-methylsulfanyl-1,3,5-triazine (PubChem CID 12870888) has the molecular formula C8H6ClN3OS and a molecular weight of 227.68 g/mol. Its IUPAC name is 2-chloro-4-(furan-2-yl)-6-methylsulfanyl-1,3,5-triazine.
| Compound Name | 2-chloro-4-(furan-2-yl)-6-methylsulfanyl-1,3,5-triazine |
|---|---|
| PubChem CID | 12870888 |
| Molecular Formula | C8H6ClN3OS |
| Molecular Weight | 227.68 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 2-chloro-4-(furan-2-yl)-6-methylsulfanyl-1,3,5-triazine |
| SMILES | CSc1nc(Cl)nc(-c2ccco2)n1 |
| InChI | InChI=1S/C8H6ClN3OS/c1-14-8-11-6(10-7(9)12-8)5-3-2-4-13-5/h2-4H,1H3 |
| InChIKey | LWGFGYBIZCXGLB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.68 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_pyridine_A(1)', 'substructure': 'N/A'} |
|---|