C8H3F3N2O — CID 164652179
4,5,6-trifluoro-2-(furan-2-yl)pyrimidine (PubChem CID 164652179) has the molecular formula C8H3F3N2O and a molecular weight of 200.12 g/mol. Its IUPAC name is 4,5,6-trifluoro-2-(furan-2-yl)pyrimidine.
| Compound Name | 4,5,6-trifluoro-2-(furan-2-yl)pyrimidine |
|---|---|
| PubChem CID | 164652179 |
| Molecular Formula | C8H3F3N2O |
| Molecular Weight | 200.12 g/mol |
| Exact Mass | 200.02 |
| IUPAC Name | 4,5,6-trifluoro-2-(furan-2-yl)pyrimidine |
| SMILES | Fc1nc(-c2ccco2)nc(F)c1F |
| InChI | InChI=1S/C8H3F3N2O/c9-5-6(10)12-8(13-7(5)11)4-2-1-3-14-4/h1-3H |
| InChIKey | IFJAFFWHYXHUJK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.12 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |