C7H5N3O — CID 11367075
3-(furan-2-yl)-1,2,4-triazine (PubChem CID 11367075) has the molecular formula C7H5N3O and a molecular weight of 147.14 g/mol. Its IUPAC name is 3-(furan-2-yl)-1,2,4-triazine.
| Compound Name | 3-(furan-2-yl)-1,2,4-triazine |
|---|---|
| PubChem CID | 11367075 |
| Molecular Formula | C7H5N3O |
| Molecular Weight | 147.14 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | 3-(furan-2-yl)-1,2,4-triazine |
| SMILES | c1coc(-c2nccnn2)c1 |
| InChI | InChI=1S/C7H5N3O/c1-2-6(11-5-1)7-8-3-4-9-10-7/h1-5H |
| InChIKey | DANCIJWJIYGUEL-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.14 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |