C10H11N3O — CID 62201956
2-(furan-2-yl)-5,6-dimethylpyrimidin-4-amine (PubChem CID 62201956) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is 2-(furan-2-yl)-5,6-dimethylpyrimidin-4-amine.
| Compound Name | 2-(furan-2-yl)-5,6-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 62201956 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 2-(furan-2-yl)-5,6-dimethylpyrimidin-4-amine |
| SMILES | Cc1nc(-c2ccco2)nc(N)c1C |
| InChI | InChI=1S/C10H11N3O/c1-6-7(2)12-10(13-9(6)11)8-4-3-5-14-8/h3-5H,1-2H3,(H2,11,12,13) |
| InChIKey | NATVZGQTPBUIEN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |