C16H11N5O2 — CID 86603876
2-[5-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]benzaldehyde (PubChem CID 86603876) has the molecular formula C16H11N5O2 and a molecular weight of 305.30 g/mol. Its IUPAC name is 2-[5-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]benzaldehyde.
| Compound Name | 2-[5-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]benzaldehyde |
|---|---|
| PubChem CID | 86603876 |
| Molecular Formula | C16H11N5O2 |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 2-[5-amino-2-(furan-2-yl)-[1,2,4]triazolo[1,5-c]pyrimidin-7-yl]benzaldehyde |
| SMILES | Nc1nc(-c2ccccc2C=O)cc2nc(-c3ccco3)nn12 |
| InChI | InChI=1S/C16H11N5O2/c17-16-18-12(11-5-2-1-4-10(11)9-22)8-14-19-15(20-21(14)16)13-6-3-7-23-13/h1-9H,(H2,17,18) |
| InChIKey | KZDVZIQXORMYFB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 99.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|