C12H7ClN2OS — CID 117141103
3-(5-chlorothiophen-2-yl)imidazo[1,5-a]pyridine-5-carbaldehyde (PubChem CID 117141103) has the molecular formula C12H7ClN2OS and a molecular weight of 262.72 g/mol. Its IUPAC name is 3-(5-chlorothiophen-2-yl)imidazo[1,5-a]pyridine-5-carbaldehyde.
| Compound Name | 3-(5-chlorothiophen-2-yl)imidazo[1,5-a]pyridine-5-carbaldehyde |
|---|---|
| PubChem CID | 117141103 |
| Molecular Formula | C12H7ClN2OS |
| Molecular Weight | 262.72 g/mol |
| Exact Mass | 262.00 |
| IUPAC Name | 3-(5-chlorothiophen-2-yl)imidazo[1,5-a]pyridine-5-carbaldehyde |
| SMILES | O=Cc1cccc2cnc(-c3ccc(Cl)s3)n12 |
| InChI | InChI=1S/C12H7ClN2OS/c13-11-5-4-10(17-11)12-14-6-8-2-1-3-9(7-16)15(8)12/h1-7H |
| InChIKey | TTYCNRWCRJPVEP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.72 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|