C13H22N4O2 — CID 65087906
1-(4,4-dimethylcycloheptyl)-3-methyl-4-nitropyrazol-5-amine (PubChem CID 65087906) has the molecular formula C13H22N4O2 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-(4,4-dimethylcycloheptyl)-3-methyl-4-nitropyrazol-5-amine.
| Compound Name | 1-(4,4-dimethylcycloheptyl)-3-methyl-4-nitropyrazol-5-amine |
|---|---|
| PubChem CID | 65087906 |
| Molecular Formula | C13H22N4O2 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | 1-(4,4-dimethylcycloheptyl)-3-methyl-4-nitropyrazol-5-amine |
| SMILES | Cc1nn(C2CCCC(C)(C)CC2)c(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H22N4O2/c1-9-11(17(18)19)12(14)16(15-9)10-5-4-7-13(2,3)8-6-10/h10H,4-8,14H2,1-3H3 |
| InChIKey | INNORAQQHDAKFN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|