C17H13Cl2N3O2 — CID 50884208
4-(3,4-dichlorophenyl)-3,5-dimethyl-1-(4-nitrophenyl)pyrazole (PubChem CID 50884208) has the molecular formula C17H13Cl2N3O2 and a molecular weight of 362.22 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-3,5-dimethyl-1-(4-nitrophenyl)pyrazole.
| Compound Name | 4-(3,4-dichlorophenyl)-3,5-dimethyl-1-(4-nitrophenyl)pyrazole |
|---|---|
| PubChem CID | 50884208 |
| Molecular Formula | C17H13Cl2N3O2 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.04 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-3,5-dimethyl-1-(4-nitrophenyl)pyrazole |
| SMILES | Cc1nn(-c2ccc([N+](=O)[O-])cc2)c(C)c1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H13Cl2N3O2/c1-10-17(12-3-8-15(18)16(19)9-12)11(2)21(20-10)13-4-6-14(7-5-13)22(23)24/h3-9H,1-2H3 |
| InChIKey | PPZASBUZSDIWLK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|