C11H10ClN3O2 — CID 71501870
5-chloro-1,3-dimethyl-4-(4-nitrophenyl)pyrazole (PubChem CID 71501870) has the molecular formula C11H10ClN3O2 and a molecular weight of 251.67 g/mol. Its IUPAC name is 5-chloro-1,3-dimethyl-4-(4-nitrophenyl)pyrazole.
| Compound Name | 5-chloro-1,3-dimethyl-4-(4-nitrophenyl)pyrazole |
|---|---|
| PubChem CID | 71501870 |
| Molecular Formula | C11H10ClN3O2 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 5-chloro-1,3-dimethyl-4-(4-nitrophenyl)pyrazole |
| SMILES | Cc1nn(C)c(Cl)c1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H10ClN3O2/c1-7-10(11(12)14(2)13-7)8-3-5-9(6-4-8)15(16)17/h3-6H,1-2H3 |
| InChIKey | HZIYBWDAUFFYFR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|