C15H13ClN2 — CID 71502219
5-chloro-1,3-dimethyl-4-naphthalen-2-ylpyrazole (PubChem CID 71502219) has the molecular formula C15H13ClN2 and a molecular weight of 256.74 g/mol. Its IUPAC name is 5-chloro-1,3-dimethyl-4-naphthalen-2-ylpyrazole.
| Compound Name | 5-chloro-1,3-dimethyl-4-naphthalen-2-ylpyrazole |
|---|---|
| PubChem CID | 71502219 |
| Molecular Formula | C15H13ClN2 |
| Molecular Weight | 256.74 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 5-chloro-1,3-dimethyl-4-naphthalen-2-ylpyrazole |
| SMILES | Cc1nn(C)c(Cl)c1-c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H13ClN2/c1-10-14(15(16)18(2)17-10)13-8-7-11-5-3-4-6-12(11)9-13/h3-9H,1-2H3 |
| InChIKey | QFZHBNCSYNQHMH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.74 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |