C21H14Cl2N2O — CID 22185179
5,6-dichloro-1-methyl-3-naphthalen-2-yl-4-pyridin-4-ylpyridin-2-one (PubChem CID 22185179) has the molecular formula C21H14Cl2N2O and a molecular weight of 381.26 g/mol. Its IUPAC name is 5,6-dichloro-1-methyl-3-naphthalen-2-yl-4-pyridin-4-ylpyridin-2-one.
| Compound Name | 5,6-dichloro-1-methyl-3-naphthalen-2-yl-4-pyridin-4-ylpyridin-2-one |
|---|---|
| PubChem CID | 22185179 |
| Molecular Formula | C21H14Cl2N2O |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 5,6-dichloro-1-methyl-3-naphthalen-2-yl-4-pyridin-4-ylpyridin-2-one |
| SMILES | Cn1c(Cl)c(Cl)c(-c2ccncc2)c(-c2ccc3ccccc3c2)c1=O |
| InChI | InChI=1S/C21H14Cl2N2O/c1-25-20(23)19(22)17(14-8-10-24-11-9-14)18(21(25)26)16-7-6-13-4-2-3-5-15(13)12-16/h2-12H,1H3 |
| InChIKey | LOOPFQHHTVSUTA-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|