C34H25N3O — CID 167485273
1,3-dimethyl-5-[10-(4-pyridin-4-ylphenyl)anthracen-9-yl]benzimidazol-2-one (PubChem CID 167485273) has the molecular formula C34H25N3O and a molecular weight of 491.59 g/mol. Its IUPAC name is 1,3-dimethyl-5-[10-(4-pyridin-4-ylphenyl)anthracen-9-yl]benzimidazol-2-one.
| Compound Name | 1,3-dimethyl-5-[10-(4-pyridin-4-ylphenyl)anthracen-9-yl]benzimidazol-2-one |
|---|---|
| PubChem CID | 167485273 |
| Molecular Formula | C34H25N3O |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 1,3-dimethyl-5-[10-(4-pyridin-4-ylphenyl)anthracen-9-yl]benzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2cc(-c3c4ccccc4c(-c4ccc(-c5ccncc5)cc4)c4ccccc34)ccc21 |
| InChI | InChI=1S/C34H25N3O/c1-36-30-16-15-25(21-31(30)37(2)34(36)38)33-28-9-5-3-7-26(28)32(27-8-4-6-10-29(27)33)24-13-11-22(12-14-24)23-17-19-35-20-18-23/h3-21H,1-2H3 |
| InChIKey | PABZXBVSRMRCNZ-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|