C32H25N3O — CID 167485024
5-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-1,3-dimethylbenzimidazol-2-one (PubChem CID 167485024) has the molecular formula C32H25N3O and a molecular weight of 467.57 g/mol. Its IUPAC name is 5-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 167485024 |
| Molecular Formula | C32H25N3O |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 5-[4-(2,6-diphenyl-4-pyridinyl)phenyl]-1,3-dimethylbenzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2cc(-c3ccc(-c4cc(-c5ccccc5)nc(-c5ccccc5)c4)cc3)ccc21 |
| InChI | InChI=1S/C32H25N3O/c1-34-30-18-17-26(21-31(30)35(2)32(34)36)22-13-15-23(16-14-22)27-19-28(24-9-5-3-6-10-24)33-29(20-27)25-11-7-4-8-12-25/h3-21H,1-2H3 |
| InChIKey | HPLUHCQUXHUVNS-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |