C37H27N3O — CID 167485196
5-[4-(4,6-diphenyl-2-pyridinyl)phenyl]-3-methyl-1-phenylbenzimidazol-2-one (PubChem CID 167485196) has the molecular formula C37H27N3O and a molecular weight of 529.64 g/mol. Its IUPAC name is 5-[4-(4,6-diphenyl-2-pyridinyl)phenyl]-3-methyl-1-phenylbenzimidazol-2-one.
| Compound Name | 5-[4-(4,6-diphenyl-2-pyridinyl)phenyl]-3-methyl-1-phenylbenzimidazol-2-one |
|---|---|
| PubChem CID | 167485196 |
| Molecular Formula | C37H27N3O |
| Molecular Weight | 529.64 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | 5-[4-(4,6-diphenyl-2-pyridinyl)phenyl]-3-methyl-1-phenylbenzimidazol-2-one |
| SMILES | Cn1c(=O)n(-c2ccccc2)c2ccc(-c3ccc(-c4cc(-c5ccccc5)cc(-c5ccccc5)n4)cc3)cc21 |
| InChI | InChI=1S/C37H27N3O/c1-39-36-25-30(21-22-35(36)40(37(39)41)32-15-9-4-10-16-32)27-17-19-29(20-18-27)34-24-31(26-11-5-2-6-12-26)23-33(38-34)28-13-7-3-8-14-28/h2-25H,1H3 |
| InChIKey | XYKWVXSGTBYLIA-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.64 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |