C46H31N5O — CID 172507759
5-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-1,3-diphenylbenzimidazol-2-one (PubChem CID 172507759) has the molecular formula C46H31N5O and a molecular weight of 669.79 g/mol. Its IUPAC name is 5-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-1,3-diphenylbenzimidazol-2-one.
| Compound Name | 5-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-1,3-diphenylbenzimidazol-2-one |
|---|---|
| PubChem CID | 172507759 |
| Molecular Formula | C46H31N5O |
| Molecular Weight | 669.79 g/mol |
| Exact Mass | 669.25 |
| IUPAC Name | 5-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-1,3-diphenylbenzimidazol-2-one |
| SMILES | O=c1n(-c2ccccc2)c2ccc(-c3ccc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)cc3)cc2n1-c1ccccc1 |
| InChI | InChI=1S/C46H31N5O/c52-46-50(39-17-9-3-10-18-39)41-30-29-38(31-42(41)51(46)40-19-11-4-12-20-40)34-23-21-32(22-24-34)33-25-27-37(28-26-33)45-48-43(35-13-5-1-6-14-35)47-44(49-45)36-15-7-2-8-16-36/h1-31H |
| InChIKey | LPWSWOWXFQZLPX-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.79 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |