C38H25N7O — CID 172507154
5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,3-dipyridin-2-ylbenzimidazol-2-one (PubChem CID 172507154) has the molecular formula C38H25N7O and a molecular weight of 595.67 g/mol. Its IUPAC name is 5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,3-dipyridin-2-ylbenzimidazol-2-one.
| Compound Name | 5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,3-dipyridin-2-ylbenzimidazol-2-one |
|---|---|
| PubChem CID | 172507154 |
| Molecular Formula | C38H25N7O |
| Molecular Weight | 595.67 g/mol |
| Exact Mass | 595.21 |
| IUPAC Name | 5-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-1,3-dipyridin-2-ylbenzimidazol-2-one |
| SMILES | O=c1n(-c2ccccn2)c2ccc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)cc2n1-c1ccccn1 |
| InChI | InChI=1S/C38H25N7O/c46-38-44(33-15-7-9-23-39-33)31-22-21-30(25-32(31)45(38)34-16-8-10-24-40-34)26-17-19-29(20-18-26)37-42-35(27-11-3-1-4-12-27)41-36(43-37)28-13-5-2-6-14-28/h1-25H |
| InChIKey | JSVXSQRNWXRNNJ-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 91.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.67 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |