C22H16N2O — CID 629641
4,6-diphenyl-1-pyridin-2-ylpyridin-2-one (PubChem CID 629641) has the molecular formula C22H16N2O and a molecular weight of 324.38 g/mol. Its IUPAC name is 4,6-diphenyl-1-pyridin-2-ylpyridin-2-one.
| Compound Name | 4,6-diphenyl-1-pyridin-2-ylpyridin-2-one |
|---|---|
| PubChem CID | 629641 |
| Molecular Formula | C22H16N2O |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 4,6-diphenyl-1-pyridin-2-ylpyridin-2-one |
| SMILES | O=c1cc(-c2ccccc2)cc(-c2ccccc2)n1-c1ccccn1 |
| InChI | InChI=1S/C22H16N2O/c25-22-16-19(17-9-3-1-4-10-17)15-20(18-11-5-2-6-12-18)24(22)21-13-7-8-14-23-21/h1-16H |
| InChIKey | GJCCSLWSOBMUTC-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |