C18H16N2O — CID 11778207
1-(methylamino)-4,6-diphenylpyridin-2-one (PubChem CID 11778207) has the molecular formula C18H16N2O and a molecular weight of 276.34 g/mol. Its IUPAC name is 1-(methylamino)-4,6-diphenylpyridin-2-one.
| Compound Name | 1-(methylamino)-4,6-diphenylpyridin-2-one |
|---|---|
| PubChem CID | 11778207 |
| Molecular Formula | C18H16N2O |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 1-(methylamino)-4,6-diphenylpyridin-2-one |
| SMILES | CNn1c(-c2ccccc2)cc(-c2ccccc2)cc1=O |
| InChI | InChI=1S/C18H16N2O/c1-19-20-17(15-10-6-3-7-11-15)12-16(13-18(20)21)14-8-4-2-5-9-14/h2-13,19H,1H3 |
| InChIKey | YHOWNSAGTGKYJO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |