C31H24N2O2 — CID 3333477
4-methyl-N-(2-oxo-4,6-diphenyl-1-pyridinyl)-N-phenylbenzamide (PubChem CID 3333477) has the molecular formula C31H24N2O2 and a molecular weight of 456.55 g/mol. Its IUPAC name is 4-methyl-N-(2-oxo-4,6-diphenyl-1-pyridinyl)-N-phenylbenzamide.
| Compound Name | 4-methyl-N-(2-oxo-4,6-diphenyl-1-pyridinyl)-N-phenylbenzamide |
|---|---|
| PubChem CID | 3333477 |
| Molecular Formula | C31H24N2O2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 4-methyl-N-(2-oxo-4,6-diphenyl-1-pyridinyl)-N-phenylbenzamide |
| SMILES | Cc1ccc(C(=O)N(c2ccccc2)n2c(-c3ccccc3)cc(-c3ccccc3)cc2=O)cc1 |
| InChI | InChI=1S/C31H24N2O2/c1-23-17-19-26(20-18-23)31(35)32(28-15-9-4-10-16-28)33-29(25-13-7-3-8-14-25)21-27(22-30(33)34)24-11-5-2-6-12-24/h2-22H,1H3 |
| InChIKey | QGYBYCHMLONLNH-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |