C29H27N3O — CID 13287213
1-[(E)-[(E)-3-(dimethylamino)-1-(4-methylphenyl)prop-2-enylidene]amino]-4,6-diphenylpyridin-2-one (PubChem CID 13287213) has the molecular formula C29H27N3O and a molecular weight of 433.56 g/mol. Its IUPAC name is 1-[(E)-[(E)-3-(dimethylamino)-1-(4-methylphenyl)prop-2-enylidene]amino]-4,6-diphenylpyridin-2-one.
| Compound Name | 1-[(E)-[(E)-3-(dimethylamino)-1-(4-methylphenyl)prop-2-enylidene]amino]-4,6-diphenylpyridin-2-one |
|---|---|
| PubChem CID | 13287213 |
| Molecular Formula | C29H27N3O |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 1-[(E)-[(E)-3-(dimethylamino)-1-(4-methylphenyl)prop-2-enylidene]amino]-4,6-diphenylpyridin-2-one |
| SMILES | Cc1ccc(C(/C=C/N(C)C)=N/n2c(-c3ccccc3)cc(-c3ccccc3)cc2=O)cc1 |
| InChI | InChI=1S/C29H27N3O/c1-22-14-16-24(17-15-22)27(18-19-31(2)3)30-32-28(25-12-8-5-9-13-25)20-26(21-29(32)33)23-10-6-4-7-11-23/h4-21H,1-3H3/b19-18+,30-27+ |
| InChIKey | DXMQQNMUFJBXTK-LOJQYYMKSA-N |
| XLogP | 5.82 |
| TPSA | 37.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|