About (2-oxo-4,6-diphenyl-1-pyridinyl) methanesulfonate
(2-oxo-4,6-diphenyl-1-pyridinyl) methanesulfonate (PubChem CID 19748662) has the molecular formula C18H15NO4S
and a molecular weight of 341.39 g/mol. Its IUPAC name is (2-oxo-4,6-diphenyl-1-pyridinyl) methanesulfonate.
Molecular Properties
| Compound Name | (2-oxo-4,6-diphenyl-1-pyridinyl) methanesulfonate |
| PubChem CID | 19748662 |
| Molecular Formula | C18H15NO4S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | (2-oxo-4,6-diphenyl-1-pyridinyl) methanesulfonate |
| SMILES | CS(=O)(=O)On1c(-c2ccccc2)cc(-c2ccccc2)cc1=O |
| InChI | InChI=1S/C18H15NO4S/c1-24(21,22)23-19-17(15-10-6-3-7-11-15)12-16(13-18(19)20)14-8-4-2-5-9-14/h2-13H,1H3 |
| InChIKey | QFXMKQXCRNNABY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-oxo-4,6-diphenyl-1-pyridinyl) methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-4,6-diphenyl-1-pyridinyl) methanesulfonate?
The IUPAC name of (2-oxo-4,6-diphenyl-1-pyridinyl) methanesulfonate (CID 19748662) is (2-oxo-4,6-diphenyl-1-pyridinyl) methanesulfonate.
What is the SMILES notation for (2-oxo-4,6-diphenyl-1-pyridinyl) methanesulfonate?
The canonical SMILES for (2-oxo-4,6-diphenyl-1-pyridinyl) methanesulfonate is CS(=O)(=O)On1c(-c2ccccc2)cc(-c2ccccc2)cc1=O.
What is the InChIKey of (2-oxo-4,6-diphenyl-1-pyridinyl) methanesulfonate?
The InChIKey is QFXMKQXCRNNABY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15NO4S/c1-24(21,22)23-19-17(15-10-6-3-7-11-15)12-16(13-18(19)20)14-8-4-2-5-9-14/h2-13H,1H3.
What are the key properties of (2-oxo-4,6-diphenyl-1-pyridinyl) methanesulfonate?
(2-oxo-4,6-diphenyl-1-pyridinyl) methanesulfonate has a molecular weight of 341.39 g/mol, XLogP of 2.57, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-4,6-diphenyl-1-pyridinyl) methanesulfonate is sourced from PubChem (CID 19748662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).