C7H4N2O2S2 — CID 163929369
4-pyridin-2-yl-1,2,4-dithiazolidine-3,5-dione (PubChem CID 163929369) has the molecular formula C7H4N2O2S2 and a molecular weight of 212.26 g/mol. Its IUPAC name is 4-pyridin-2-yl-1,2,4-dithiazolidine-3,5-dione.
| Compound Name | 4-pyridin-2-yl-1,2,4-dithiazolidine-3,5-dione |
|---|---|
| PubChem CID | 163929369 |
| Molecular Formula | C7H4N2O2S2 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 211.97 |
| IUPAC Name | 4-pyridin-2-yl-1,2,4-dithiazolidine-3,5-dione |
| SMILES | O=c1ssc(=O)n1-c1ccccn1 |
| InChI | InChI=1S/C7H4N2O2S2/c10-6-9(7(11)13-12-6)5-3-1-2-4-8-5/h1-4H |
| InChIKey | RHJYYCLXRKKRAU-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |