C8H6N4O2 — CID 175968865
3-pyridin-2-yl-1H-1,3,5-triazine-2,4-dione (PubChem CID 175968865) has the molecular formula C8H6N4O2 and a molecular weight of 190.16 g/mol. Its IUPAC name is 3-pyridin-2-yl-1H-1,3,5-triazine-2,4-dione.
| Compound Name | 3-pyridin-2-yl-1H-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 175968865 |
| Molecular Formula | C8H6N4O2 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 3-pyridin-2-yl-1H-1,3,5-triazine-2,4-dione |
| SMILES | O=c1nc[nH]c(=O)n1-c1ccccn1 |
| InChI | InChI=1S/C8H6N4O2/c13-7-10-5-11-8(14)12(7)6-3-1-2-4-9-6/h1-5H,(H,10,11,13,14) |
| InChIKey | VIVNKIAAVJRJCZ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |