C8H6N2OS — CID 44564009
2-pyridin-2-yl-1,2-thiazol-3-one (PubChem CID 44564009) has the molecular formula C8H6N2OS and a molecular weight of 178.22 g/mol. Its IUPAC name is 2-pyridin-2-yl-1,2-thiazol-3-one.
| Compound Name | 2-pyridin-2-yl-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 44564009 |
| Molecular Formula | C8H6N2OS |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.02 |
| IUPAC Name | 2-pyridin-2-yl-1,2-thiazol-3-one |
| SMILES | O=c1ccsn1-c1ccccn1 |
| InChI | InChI=1S/C8H6N2OS/c11-8-4-6-12-10(8)7-3-1-2-5-9-7/h1-6H |
| InChIKey | LDQGZDZYAMGIRK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |