C12H9ClN4O2 — CID 124927414
4-chloro-1,3-dimethyl-7-nitropyrazolo[3,4-b]quinoline (PubChem CID 124927414) has the molecular formula C12H9ClN4O2 and a molecular weight of 276.68 g/mol. Its IUPAC name is 4-chloro-1,3-dimethyl-7-nitropyrazolo[3,4-b]quinoline.
| Compound Name | 4-chloro-1,3-dimethyl-7-nitropyrazolo[3,4-b]quinoline |
|---|---|
| PubChem CID | 124927414 |
| Molecular Formula | C12H9ClN4O2 |
| Molecular Weight | 276.68 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 4-chloro-1,3-dimethyl-7-nitropyrazolo[3,4-b]quinoline |
| SMILES | Cc1nn(C)c2nc3cc([N+](=O)[O-])ccc3c(Cl)c12 |
| InChI | InChI=1S/C12H9ClN4O2/c1-6-10-11(13)8-4-3-7(17(18)19)5-9(8)14-12(10)16(2)15-6/h3-5H,1-2H3 |
| InChIKey | QDXZGXNIDWAVGT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.68 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|