C18H18ClN5O3 — CID 16962912
N-[(2-chloro-5-nitrophenyl)methyl]-N,1,3,6-tetramethylpyrazolo[3,4-b]pyridine-4-carboxamide (PubChem CID 16962912) has the molecular formula C18H18ClN5O3 and a molecular weight of 387.83 g/mol. Its IUPAC name is N-[(2-chloro-5-nitrophenyl)methyl]-N,1,3,6-tetramethylpyrazolo[3,4-b]pyridine-4-carboxamide.
| Compound Name | N-[(2-chloro-5-nitrophenyl)methyl]-N,1,3,6-tetramethylpyrazolo[3,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 16962912 |
| Molecular Formula | C18H18ClN5O3 |
| Molecular Weight | 387.83 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | N-[(2-chloro-5-nitrophenyl)methyl]-N,1,3,6-tetramethylpyrazolo[3,4-b]pyridine-4-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)Cc2cc([N+](=O)[O-])ccc2Cl)c2c(C)nn(C)c2n1 |
| InChI | InChI=1S/C18H18ClN5O3/c1-10-7-14(16-11(2)21-23(4)17(16)20-10)18(25)22(3)9-12-8-13(24(26)27)5-6-15(12)19/h5-8H,9H2,1-4H3 |
| InChIKey | DTUWKCJOHINXBB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.83 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|