C14H10ClN3O4 — CID 144939722
9-chloro-2-methyl-1,6-dinitro-2,3-dihydroacridine (PubChem CID 144939722) has the molecular formula C14H10ClN3O4 and a molecular weight of 319.70 g/mol. Its IUPAC name is 9-chloro-2-methyl-1,6-dinitro-2,3-dihydroacridine.
| Compound Name | 9-chloro-2-methyl-1,6-dinitro-2,3-dihydroacridine |
|---|---|
| PubChem CID | 144939722 |
| Molecular Formula | C14H10ClN3O4 |
| Molecular Weight | 319.70 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 9-chloro-2-methyl-1,6-dinitro-2,3-dihydroacridine |
| SMILES | CC1CC=c2nc3cc([N+](=O)[O-])ccc3c(Cl)c2=C1[N+](=O)[O-] |
| InChI | InChI=1S/C14H10ClN3O4/c1-7-2-5-10-12(14(7)18(21)22)13(15)9-4-3-8(17(19)20)6-11(9)16-10/h3-7H,2H2,1H3 |
| InChIKey | HEGZCBYOXVZVAZ-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 99.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.70 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|