C14H10N4O6 — CID 15578882
1,3-dimethyl-5-nitro-4-(4-nitrophenyl)pyrano[3,2-d]pyrazol-6-one (PubChem CID 15578882) has the molecular formula C14H10N4O6 and a molecular weight of 330.26 g/mol. Its IUPAC name is 1,3-dimethyl-5-nitro-4-(4-nitrophenyl)pyrano[3,2-d]pyrazol-6-one.
| Compound Name | 1,3-dimethyl-5-nitro-4-(4-nitrophenyl)pyrano[3,2-d]pyrazol-6-one |
|---|---|
| PubChem CID | 15578882 |
| Molecular Formula | C14H10N4O6 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 1,3-dimethyl-5-nitro-4-(4-nitrophenyl)pyrano[3,2-d]pyrazol-6-one |
| SMILES | Cc1nn(C)c2oc(=O)c([N+](=O)[O-])c(-c3ccc([N+](=O)[O-])cc3)c12 |
| InChI | InChI=1S/C14H10N4O6/c1-7-10-11(8-3-5-9(6-4-8)17(20)21)12(18(22)23)14(19)24-13(10)16(2)15-7/h3-6H,1-2H3 |
| InChIKey | GXNPPHWIBYNGCD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 134.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|