C16H13ClN4O4 — CID 102139568
5-(4-chlorophenyl)-1,3,7-trimethyl-6-nitropyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 102139568) has the molecular formula C16H13ClN4O4 and a molecular weight of 360.76 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1,3,7-trimethyl-6-nitropyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | 5-(4-chlorophenyl)-1,3,7-trimethyl-6-nitropyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 102139568 |
| Molecular Formula | C16H13ClN4O4 |
| Molecular Weight | 360.76 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 5-(4-chlorophenyl)-1,3,7-trimethyl-6-nitropyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | Cc1nc2c(c(-c3ccc(Cl)cc3)c1[N+](=O)[O-])c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C16H13ClN4O4/c1-8-13(21(24)25)11(9-4-6-10(17)7-5-9)12-14(18-8)19(2)16(23)20(3)15(12)22/h4-7H,1-3H3 |
| InChIKey | ZEHMNIAMXJEBTO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 100.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.76 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|