C14H11N5O5 — CID 137273086
1,3-dimethyl-5-(4-nitrophenyl)-6H-pyrimido[4,5-d]pyrimidine-2,4,7-trione (PubChem CID 137273086) has the molecular formula C14H11N5O5 and a molecular weight of 329.27 g/mol. Its IUPAC name is 1,3-dimethyl-5-(4-nitrophenyl)-6H-pyrimido[4,5-d]pyrimidine-2,4,7-trione.
| Compound Name | 1,3-dimethyl-5-(4-nitrophenyl)-6H-pyrimido[4,5-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 137273086 |
| Molecular Formula | C14H11N5O5 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 1,3-dimethyl-5-(4-nitrophenyl)-6H-pyrimido[4,5-d]pyrimidine-2,4,7-trione |
| SMILES | Cn1c(=O)c2c(-c3ccc([N+](=O)[O-])cc3)[nH]c(=O)nc2n(C)c1=O |
| InChI | InChI=1S/C14H11N5O5/c1-17-11-9(12(20)18(2)14(17)22)10(15-13(21)16-11)7-3-5-8(6-4-7)19(23)24/h3-6H,1-2H3,(H,15,16,21) |
| InChIKey | RPLZYTHKYSHGJT-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 132.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|