C19H22N4O5 — CID 137273088
5-[4-(diethoxymethyl)phenyl]-1,3-dimethyl-6H-pyrimido[4,5-d]pyrimidine-2,4,7-trione (PubChem CID 137273088) has the molecular formula C19H22N4O5 and a molecular weight of 386.41 g/mol. Its IUPAC name is 5-[4-(diethoxymethyl)phenyl]-1,3-dimethyl-6H-pyrimido[4,5-d]pyrimidine-2,4,7-trione.
| Compound Name | 5-[4-(diethoxymethyl)phenyl]-1,3-dimethyl-6H-pyrimido[4,5-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 137273088 |
| Molecular Formula | C19H22N4O5 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 5-[4-(diethoxymethyl)phenyl]-1,3-dimethyl-6H-pyrimido[4,5-d]pyrimidine-2,4,7-trione |
| SMILES | CCOC(OCC)c1ccc(-c2[nH]c(=O)nc3c2c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C19H22N4O5/c1-5-27-17(28-6-2)12-9-7-11(8-10-12)14-13-15(21-18(25)20-14)22(3)19(26)23(4)16(13)24/h7-10,17H,5-6H2,1-4H3,(H,20,21,25) |
| InChIKey | IVNPDGHUSRZDSS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|