C20H19N3O4 — CID 78365711
11,13-dimethyl-8-(4-propan-2-ylphenyl)-5-oxa-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1,3(7),8-triene-6,10,12-trione (PubChem CID 78365711) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is 11,13-dimethyl-8-(4-propan-2-ylphenyl)-5-oxa-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1,3(7),8-triene-6,10,12-trione.
| Compound Name | 11,13-dimethyl-8-(4-propan-2-ylphenyl)-5-oxa-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1,3(7),8-triene-6,10,12-trione |
|---|---|
| PubChem CID | 78365711 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 11,13-dimethyl-8-(4-propan-2-ylphenyl)-5-oxa-2,11,13-triazatricyclo[7.4.0.03,7]trideca-1,3(7),8-triene-6,10,12-trione |
| SMILES | CC(C)c1ccc(-c2c3c(nc4c2c(=O)n(C)c(=O)n4C)COC3=O)cc1 |
| InChI | InChI=1S/C20H19N3O4/c1-10(2)11-5-7-12(8-6-11)14-15-13(9-27-19(15)25)21-17-16(14)18(24)23(4)20(26)22(17)3/h5-8,10H,9H2,1-4H3 |
| InChIKey | OPDCHSMTBITRHC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 83.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |