C19H23N4O5+ — CID 74925758
5-[4-(diethoxymethyl)phenyl]-1,3-dimethyl-6H-pyrimido[4,5-d]pyrimidin-8-ium-2,4,7-trione (PubChem CID 74925758) has the molecular formula C19H23N4O5+ and a molecular weight of 387.42 g/mol. Its IUPAC name is 5-[4-(diethoxymethyl)phenyl]-1,3-dimethyl-6H-pyrimido[4,5-d]pyrimidin-8-ium-2,4,7-trione.
| Compound Name | 5-[4-(diethoxymethyl)phenyl]-1,3-dimethyl-6H-pyrimido[4,5-d]pyrimidin-8-ium-2,4,7-trione |
|---|---|
| PubChem CID | 74925758 |
| Molecular Formula | C19H23N4O5+ |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 5-[4-(diethoxymethyl)phenyl]-1,3-dimethyl-6H-pyrimido[4,5-d]pyrimidin-8-ium-2,4,7-trione |
| SMILES | CCOC(OCC)c1ccc(-c2[nH]c(=O)[nH+]c3c2c(=O)n(C)c(=O)n3C)cc1 |
| InChI | InChI=1S/C19H22N4O5/c1-5-27-17(28-6-2)12-9-7-11(8-10-12)14-13-15(21-18(25)20-14)22(3)19(26)23(4)16(13)24/h7-10,17H,5-6H2,1-4H3,(H,20,21,25)/p+1 |
| InChIKey | IVNPDGHUSRZDSS-UHFFFAOYSA-O |
| XLogP | 0.48 |
| TPSA | 109.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|