C15H11N5O4S — CID 632112
2,4-dimethyl-7-(4-nitrophenyl)purino[8,7-b][1,3]thiazole-1,3-dione (PubChem CID 632112) has the molecular formula C15H11N5O4S and a molecular weight of 357.35 g/mol. Its IUPAC name is 2,4-dimethyl-7-(4-nitrophenyl)purino[8,7-b][1,3]thiazole-1,3-dione.
| Compound Name | 2,4-dimethyl-7-(4-nitrophenyl)purino[8,7-b][1,3]thiazole-1,3-dione |
|---|---|
| PubChem CID | 632112 |
| Molecular Formula | C15H11N5O4S |
| Molecular Weight | 357.35 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 2,4-dimethyl-7-(4-nitrophenyl)purino[8,7-b][1,3]thiazole-1,3-dione |
| SMILES | Cn1c(=O)c2c(nc3sc(-c4ccc([N+](=O)[O-])cc4)cn32)n(C)c1=O |
| InChI | InChI=1S/C15H11N5O4S/c1-17-12-11(13(21)18(2)15(17)22)19-7-10(25-14(19)16-12)8-3-5-9(6-4-8)20(23)24/h3-7H,1-2H3 |
| InChIKey | DWLKDEHAIOJQMU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 104.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|