C12H10ClN3O5 — CID 61031664
5-(2-chloro-4-nitrophenoxy)-1,3-dimethylpyrazole-4-carboxylic acid (PubChem CID 61031664) has the molecular formula C12H10ClN3O5 and a molecular weight of 311.68 g/mol. Its IUPAC name is 5-(2-chloro-4-nitrophenoxy)-1,3-dimethylpyrazole-4-carboxylic acid.
| Compound Name | 5-(2-chloro-4-nitrophenoxy)-1,3-dimethylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 61031664 |
| Molecular Formula | C12H10ClN3O5 |
| Molecular Weight | 311.68 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | 5-(2-chloro-4-nitrophenoxy)-1,3-dimethylpyrazole-4-carboxylic acid |
| SMILES | Cc1nn(C)c(Oc2ccc([N+](=O)[O-])cc2Cl)c1C(=O)O |
| InChI | InChI=1S/C12H10ClN3O5/c1-6-10(12(17)18)11(15(2)14-6)21-9-4-3-7(16(19)20)5-8(9)13/h3-5H,1-2H3,(H,17,18) |
| InChIKey | KZBNAYJJHDZUKJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.68 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|